Molecular Definition

Canonical SMILES [H]C12CC(=O)CCC1([H])C(C)(C)OC1=CC(=CC(O)=C21)C(C)(C)CCCCCC
Formula C24H36O3
Molecular Weight 372.54 da
Stereocenters 0/2