Target Relevance

Molecular Definition

Canonical SMILES CCCCCCC(=O)CCCCCC/C=C/C[C@H]([C@@H]([C@](C(=O)O)(CO)N)O)O
Formula C21H39NO6
Molecular Weight 401.54 da
Stereocenters 3/3