Synonym

Molecular Definition

Canonical SMILES [H][C@@]1(C[C@H]2CO[C@@H](C\C(C)=C\C(=O)OCCCCCCCCC(O)=O)[C@H](O)[C@@H]2O)O[C@@]1([H])[C@@H](C)[C@H](C)O
Formula C26H44O9
Molecular Weight 500.62 da
Stereocenters 8/8