Molecular Definition

Canonical SMILES CCOC1=C(C=C(Cl)C(N)=C1)C(=O)NCC1CN(CC2=CC=C(F)C=C2)CCO1
Formula C21H25ClFN3O3
Molecular Weight 421.89 da
Stereocenters 0/1