Molecular Definition

Canonical SMILES NC(=O)CS(=O)C(C1=CC=CC=C1)C1=CC=CC=C1
Formula C15H15NO2S
Molecular Weight 273.35 da
Stereocenters 0/0