Target Relevance

Molecular Definition

Canonical SMILES NC1=NC(CC(=O)NC2=CC=C(CCNC[C@H](O)C3=CC=CC=C3)C=C2)=CS1
Formula C21H24N4O2S
Molecular Weight 396.51 da
Stereocenters 1/1