Molecular Definition

Canonical SMILES OC[C@H]1NC[C@H](O)[C@@H](O)[C@H]1O
Formula C6H13NO4
Molecular Weight 163.17 da
Stereocenters 4/4