Target Relevance

Molecular Definition

Canonical SMILES COC1=CC(C(O)CNC(=O)CN)=C(OC)C=C1
Formula C12H18N2O4
Molecular Weight 254.28 da
Stereocenters 0/1