Molecular Definition

Canonical SMILES CC1=NC=C2CN=C(C3=CC(Cl)=CC=C3N12)C1=C(F)C=CC=C1
Formula C18H13ClFN3
Molecular Weight 325.77 da
Stereocenters 0/0