Molecular Definition

Canonical SMILES CCN(CC)CCNC(=O)C1=C(OC)C=C(N)C(Cl)=C1
Formula C14H22ClN3O2
Molecular Weight 299.80 da
Stereocenters 0/0