Molecular Definition

Canonical SMILES CN1CCCC(CC2C3=CC=CC=C3SC3=C2C=CC=C3)C1
Formula C20H23NS
Molecular Weight 309.47 da
Stereocenters 0/1