Molecular Definition

Canonical SMILES [H][C@@]12CC3=CNC4=CC=CC(=C34)C1=C[C@H](CN2C)C(=O)N[C@@H](CC)CO
Formula C20H25N3O2
Molecular Weight 339.43 da
Stereocenters 3/3