Molecular Definition

Canonical SMILES CCOC(=O)[C@@](C)(N)CC1=CC(O)=C(O)C=C1
Formula C12H17NO4
Molecular Weight 239.27 da
Stereocenters 1/1