Molecular Definition

Canonical SMILES C[C@](N)(Cc1ccc(O)c(O)c1)C(=O)O
Formula C10H13NO4
Molecular Weight 211.21 da
Stereocenters 1/1