Molecular Definition

Canonical SMILES CN(CC1=CN=C2N=C(N)N=C(N)C2=N1)C1=CC=C(C=C1)C(=O)N[C@@H](CCC(O)=O)C(O)=O
Formula C20H22N8O5
Molecular Weight 454.44 da
Stereocenters 1/1