Molecular Definition

Canonical SMILES CCC1(CC)C(=O)NC(=O)N(C)C1=O
Formula C9H14N2O3
Molecular Weight 198.22 da
Stereocenters 0/0