Molecular Definition

Canonical SMILES CC[N+](C)(CC)CCOC(=O)C1C2=CC=CC=C2OC2=C1C=CC=C2
Formula C21H26NO3
Molecular Weight 340.44 da
Stereocenters 0/1