Target Relevance

Molecular Definition

Canonical SMILES C[C@H](N)[C@H](O)C1=CC(O)=CC=C1
Formula C9H13NO2
Molecular Weight 167.21 da
Stereocenters 2/2