Molecular Definition

Canonical SMILES [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(OC)C=C3
Formula C21H26O2
Molecular Weight 310.43 da
Stereocenters 5/5