Molecular Definition

Canonical SMILES COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2
Formula C13H16N2O2
Molecular Weight 232.28 da
Stereocenters 0/0