Target Relevance

Molecular Definition

Canonical SMILES [H][C@@]12CC3=CNC4=CC=CC(=C34)C1=C[C@H](CN2C)C(=O)N(CC)CC
Formula C20H25N3O
Molecular Weight 323.43 da
Stereocenters 2/2