Molecular Definition

Canonical SMILES CC1=CC=C(NC(=O)C2(CC2)C2=CC=C3OC(F)(F)OC3=C2)N=C1C1=CC=CC(=C1)C(O)=O
Formula C24H18F2N2O5
Molecular Weight 452.41 da
Stereocenters 0/0