Molecular Definition

Canonical SMILES CN1CCN(CC1)C1=NC2=C(OC3=CC=C(Cl)C=C13)C=CC=C2
Formula C18H18ClN3O
Molecular Weight 327.81 da
Stereocenters 0/0