losartan
An antagonist of ANGIOTENSIN TYPE 1 RECEPTOR with antihypertensive activity due to the reduced pressor effect of ANGIOTENSIN II.
Target Relevance
| Type-2 angiotensin II receptor | Tchem |
| pKd 2908 | 8.43 |
| Type-1 angiotensin II receptor | Tclin |
| ANTAGONIST 350 | |
| pIC50 143077 | 9.48 |
| pIC50 143077 | 8.26 |
Molecular Definition
| Canonical SMILES | CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=C1)C1=C(C=CC=C1)C1=NN=NN1 |
| Formula | C22H23ClN6O |
| Molecular Weight | 422.91 da |
| Stereocenters | 0/0 |