Molecular Definition

Canonical SMILES CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=C1)C1=C(C=CC=C1)C1=NN=NN1
Formula C22H23ClN6O
Molecular Weight 422.91 da
Stereocenters 0/0