Molecular Definition

Canonical SMILES OC1N=C(C2=CC(Cl)=CC=C2NC1=O)C1=C(Cl)C=CC=C1
Formula C15H10Cl2N2O2
Molecular Weight 321.16 da
Stereocenters 0/1