Molecular Definition

Canonical SMILES CN(C)C(=O)C(CCN1CCC(O)(CC1)c2ccc(Cl)cc2)(c3ccccc3)c4ccccc4
Formula C29H33ClN2O2
Molecular Weight 477.04 da
Stereocenters 0/0