Target Relevance

GTPase KRas Tchem
pIC50 143077 8.27999973
GTPase HRas Tchem
pIC50 143077 8.72000027
GTPase NRas Tchem
pIC50 143077 8.55000019

Molecular Definition

Canonical SMILES Clc1cc(Br)c2c(c1)CCc1c([C@@H]2C2CCN(CC2)C(=O)CC2CCN(CC2)C(=O)N)ncc(c1)Br
Formula C27H31Br2ClN4O2
Molecular Weight 638.82 da
Stereocenters 1/1