Target Relevance

Molecular Definition

Canonical SMILES OC(=O)C(=O)NC1=CC(=CC(NC(=O)C(O)=O)=C1Cl)C#N
Formula C11H6ClN3O6
Molecular Weight 311.64 da
Stereocenters 0/0