Molecular Definition

Canonical SMILES N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C=C2)C(I)=C1)C(O)=O
Formula C15H12I3NO4
Molecular Weight 650.97 da
Stereocenters 1/1