Molecular Definition

Canonical SMILES CCN(CC)CC(=O)NC1=C(C)C=CC=C1C
Formula C14H22N2O
Molecular Weight 234.34 da
Stereocenters 0/0