Molecular Definition

Canonical SMILES CC(C)(C)NC[C@H](O)C1=CC(CO)=C(O)C=C1
Formula C13H21NO3
Molecular Weight 239.31 da
Stereocenters 1/1