Molecular Definition

Canonical SMILES CC1=C(C=NO1)C(=O)NC1=CC=C(C=C1)C(F)(F)F
Formula C12H9F3N2O2
Molecular Weight 270.21 da
Stereocenters 0/0