Molecular Definition

Canonical SMILES [H]C1(CCC2=CC(O)=CC=C2C1([H])C1=CC=C(OCCN2CCCC2)C=C1)C1=CC=CC=C1
Formula C28H31NO2
Molecular Weight 413.55 da
Stereocenters 0/2