Molecular Definition

Canonical SMILES CC1=C(CS(=O)C2=NC3=C(N2)C=CC=C3)N=CC=C1OCC(F)(F)F
Formula C16H14F3N3O2S
Molecular Weight 369.36 da
Stereocenters 0/0