Molecular Definition

Canonical SMILES COC[C@H](C(=O)NCc1ccccc1)NC(=O)C
Formula C13H18N2O3
Molecular Weight 250.29 da
Stereocenters 1/1