Molecular Definition

Canonical SMILES Fc1ccc(cc1)C(=O)C1CCN(CC1)CCn1c(=O)[nH]c2c(c1=O)cccc2
Formula C22H22FN3O3
Molecular Weight 395.43 da
Stereocenters 0/0