Molecular Definition

Canonical SMILES CNC1(CCCCC1=O)C1=C(Cl)C=CC=C1
Formula C13H16ClNO
Molecular Weight 237.73 da
Stereocenters 0/1