Molecular Definition

Canonical SMILES CC(C)NCC(O)c1ccc(O)c(O)c1
Formula C11H17NO3
Molecular Weight 211.26 da
Stereocenters 0/1