Molecular Definition

Canonical SMILES CC1Cc2ccccc2N1NC(=O)c3ccc(Cl)c(c3)S(=O)(=O)N
Formula C16H16ClN3O3S
Molecular Weight 365.84 da
Stereocenters 0/1