Molecular Definition

Canonical SMILES COC1=CC=NC(CS(=O)C2=NC3=C(N2)C=CC(=C3)N2C=CC=C2)=C1C
Formula C19H18N4O2S
Molecular Weight 366.44 da
Stereocenters 0/0