Molecular Definition

Canonical SMILES NC1=C2C(=NC=N1)N(N=C2C1=CC=C(OC2=CC=CC=C2)C=C1)[C@@H]1CCCN(C1)C(=O)C=C
Formula C25H24N6O2
Molecular Weight 440.50 da
Stereocenters 1/1