Molecular Definition

Canonical SMILES CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)[C@H](CO)C1=CC=CC=C1
Formula C17H23NO3
Molecular Weight 289.37 da
Stereocenters 4/4