Molecular Definition

Canonical SMILES FC(F)(F)CN1C2=CC=C(Cl)C=C2C(=NCC1=O)C1=CC=CC=C1
Formula C17H12ClF3N2O
Molecular Weight 352.74 da
Stereocenters 0/0