Molecular Definition

Canonical SMILES C[N+]1(C)CCC(C1)OC(=O)C(O)(C1CCCC1)C1=CC=CC=C1
Formula C19H28NO3
Molecular Weight 318.43 da
Stereocenters 0/3