Molecular Definition

Canonical SMILES [O-][N+](=O)OCC(CO[N+]([O-])=O)O[N+]([O-])=O
Formula C3H5N3O9
Molecular Weight 227.09 da
Stereocenters 0/0