Molecular Definition

Canonical SMILES NS(=O)(=O)C1=CC(C(O)=O)=C(NCC2=CC=CO2)C=C1Cl
Formula C12H11ClN2O5S
Molecular Weight 330.74 da
Stereocenters 0/0