Molecular Definition

Canonical SMILES [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=CC=C(O)C=C3C[C@@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)[C@@]21[H]
Formula C32H47F5O3S
Molecular Weight 606.77 da
Stereocenters 6/6