Molecular Definition

Canonical SMILES CN[C@H]1Cc2c(CC1)[nH]c1c2cc(cc1)C(=N)O
Formula C14H17N3O
Molecular Weight 243.30 da
Stereocenters 1/1