Target Relevance

Molecular Definition

Canonical SMILES OC[C@H]1O[C@H](C[C@@H]1O)N1C=C(F)C(=O)NC1=O
Formula C9H11FN2O5
Molecular Weight 246.19 da
Stereocenters 3/3