Molecular Definition

Canonical SMILES NC(=N)NC1=NC(CSCCC(=N)NS(N)(=O)=O)=CS1
Formula C8H15N7O2S3
Molecular Weight 337.45 da
Stereocenters 0/0